C21H18O3 — CID 132917425
(4S,7S)-4,7-dihydroxy-1,3-diphenyl-4,5,6,7-tetrahydroinden-2-one (PubChem CID 132917425) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is (4S,7S)-4,7-dihydroxy-1,3-diphenyl-4,5,6,7-tetrahydroinden-2-one.
| Compound Name | (4S,7S)-4,7-dihydroxy-1,3-diphenyl-4,5,6,7-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 132917425 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (4S,7S)-4,7-dihydroxy-1,3-diphenyl-4,5,6,7-tetrahydroinden-2-one |
| SMILES | O=C1C(c2ccccc2)=C2C(=C1c1ccccc1)[C@@H](O)CC[C@@H]2O |
| InChI | InChI=1S/C21H18O3/c22-15-11-12-16(23)20-18(14-9-5-2-6-10-14)21(24)17(19(15)20)13-7-3-1-4-8-13/h1-10,15-16,22-23H,11-12H2/t15-,16-/m0/s1 |
| InChIKey | GQTIQNMACZVPLZ-HOTGVXAUSA-N |
| XLogP | 2.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |