C29H18O7S2-2 — CID 122371299
4-[5-oxo-2,3-diphenyl-4-(4-sulfonatophenyl)cyclopenta-1,3-dien-1-yl]benzenesulfonate (PubChem CID 122371299) has the molecular formula C29H18O7S2-2 and a molecular weight of 542.59 g/mol. Its IUPAC name is 4-[5-oxo-2,3-diphenyl-4-(4-sulfonatophenyl)cyclopenta-1,3-dien-1-yl]benzenesulfonate.
| Compound Name | 4-[5-oxo-2,3-diphenyl-4-(4-sulfonatophenyl)cyclopenta-1,3-dien-1-yl]benzenesulfonate |
|---|---|
| PubChem CID | 122371299 |
| Molecular Formula | C29H18O7S2-2 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 4-[5-oxo-2,3-diphenyl-4-(4-sulfonatophenyl)cyclopenta-1,3-dien-1-yl]benzenesulfonate |
| SMILES | O=C1C(c2ccc(S(=O)(=O)[O-])cc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C29H20O7S2/c30-29-27(21-11-15-23(16-12-21)37(31,32)33)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)28(29)22-13-17-24(18-14-22)38(34,35)36/h1-18H,(H,31,32,33)(H,34,35,36)/p-2 |
| InChIKey | VFDFJWLWUCMZIP-UHFFFAOYSA-L |
| XLogP | 4.60 |
| TPSA | 131.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|