C10H10N2O4 — CID 135980875
4,5-dihydroxy-3-oxido-2-phenyl-4,5-dihydro-1H-pyrimidin-3-ium-6-one (PubChem CID 135980875) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 4,5-dihydroxy-3-oxido-2-phenyl-4,5-dihydro-1H-pyrimidin-3-ium-6-one.
| Compound Name | 4,5-dihydroxy-3-oxido-2-phenyl-4,5-dihydro-1H-pyrimidin-3-ium-6-one |
|---|---|
| PubChem CID | 135980875 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4,5-dihydroxy-3-oxido-2-phenyl-4,5-dihydro-1H-pyrimidin-3-ium-6-one |
| SMILES | O=C1NC(c2ccccc2)=[N+]([O-])C(O)C1O |
| InChI | InChI=1S/C10H10N2O4/c13-7-9(14)11-8(12(16)10(7)15)6-4-2-1-3-5-6/h1-5,7,10,13,15H,(H,11,14) |
| InChIKey | RARKFOJKHBLPTQ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|