C17H12N2O3 — CID 139747977
2,5-dioxo-3,4-diphenylpyrrole-1-carboxamide (PubChem CID 139747977) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2,5-dioxo-3,4-diphenylpyrrole-1-carboxamide.
| Compound Name | 2,5-dioxo-3,4-diphenylpyrrole-1-carboxamide |
|---|---|
| PubChem CID | 139747977 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2,5-dioxo-3,4-diphenylpyrrole-1-carboxamide |
| SMILES | NC(=O)N1C(=O)C(c2ccccc2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H12N2O3/c18-17(22)19-15(20)13(11-7-3-1-4-8-11)14(16(19)21)12-9-5-2-6-10-12/h1-10H,(H2,18,22) |
| InChIKey | IAFOFHRTNTWSIJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|