C17H10F3NO4S — CID 151983215
3,4-diphenyl-1-(trifluoromethylsulfonyl)pyrrole-2,5-dione (PubChem CID 151983215) has the molecular formula C17H10F3NO4S and a molecular weight of 381.33 g/mol. Its IUPAC name is 3,4-diphenyl-1-(trifluoromethylsulfonyl)pyrrole-2,5-dione.
| Compound Name | 3,4-diphenyl-1-(trifluoromethylsulfonyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 151983215 |
| Molecular Formula | C17H10F3NO4S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 3,4-diphenyl-1-(trifluoromethylsulfonyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H10F3NO4S/c18-17(19,20)26(24,25)21-15(22)13(11-7-3-1-4-8-11)14(16(21)23)12-9-5-2-6-10-12/h1-10H |
| InChIKey | UDDBISWWVAJJMV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|