C18H16F6N2O4S2 — CID 53305234
2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine (PubChem CID 53305234) has the molecular formula C18H16F6N2O4S2 and a molecular weight of 502.46 g/mol. Its IUPAC name is 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine.
| Compound Name | 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine |
|---|---|
| PubChem CID | 53305234 |
| Molecular Formula | C18H16F6N2O4S2 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine |
| SMILES | O=S(=O)(N1CC(c2ccccc2)N(S(=O)(=O)C(F)(F)F)CC1c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H16F6N2O4S2/c19-17(20,21)31(27,28)25-12-16(14-9-5-2-6-10-14)26(32(29,30)18(22,23)24)11-15(25)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2 |
| InChIKey | FJTCDBFHQVINHB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |