About 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine
2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine (PubChem CID 53305234) has the molecular formula C18H16F6N2O4S2
and a molecular weight of 502.46 g/mol. Its IUPAC name is 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine.
Molecular Properties
| Compound Name | 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine |
| PubChem CID | 53305234 |
| Molecular Formula | C18H16F6N2O4S2 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine |
| SMILES | O=S(=O)(N1CC(c2ccccc2)N(S(=O)(=O)C(F)(F)F)CC1c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H16F6N2O4S2/c19-17(20,21)31(27,28)25-12-16(14-9-5-2-6-10-14)26(32(29,30)18(22,23)24)11-15(25)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2 |
| InChIKey | FJTCDBFHQVINHB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine?
The IUPAC name of 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine (CID 53305234) is 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine.
What is the SMILES notation for 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine?
The canonical SMILES for 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine is O=S(=O)(N1CC(c2ccccc2)N(S(=O)(=O)C(F)(F)F)CC1c1ccccc1)C(F)(F)F.
What is the InChIKey of 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine?
The InChIKey is FJTCDBFHQVINHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F6N2O4S2/c19-17(20,21)31(27,28)25-12-16(14-9-5-2-6-10-14)26(32(29,30)18(22,23)24)11-15(25)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2.
What are the key properties of 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine?
2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine has a molecular weight of 502.46 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenyl-1,4-bis(trifluoromethylsulfonyl)piperazine is sourced from PubChem (CID 53305234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).