C84H84N6O18 — CID 139206037
ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (PubChem CID 139206037) has the molecular formula C84H84N6O18 and a molecular weight of 1465.62 g/mol. Its IUPAC name is ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate.
| Compound Name | ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 139206037 |
| Molecular Formula | C84H84N6O18 |
| Molecular Weight | 1465.62 g/mol |
| Exact Mass | 1464.58 |
| IUPAC Name | ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2=C(c3ccccc3)N(C(=O)OC(C)(C)C)C(=O)C2=C1c1ccccc1.CC(C)(C)OC(=O)N1C(=O)C2=C(c3ccccc3)N(C(=O)OC(C)(C)C)C(=O)C2=C1c1ccccc1.CC(C)(C)OC(=O)N1C(=O)C2=C(c3ccccc3)N(C(=O)OC(C)(C)C)C(=O)C2=C1c1ccccc1 |
| InChI | InChI=1S/3C28H28N2O6/c3*1-27(2,3)35-25(33)29-21(17-13-9-7-10-14-17)19-20(23(29)31)22(18-15-11-8-12-16-18)30(24(19)32)26(34)36-28(4,5)6/h3*7-16H,1-6H3 |
| InChIKey | IBQWQKGLFUOJFS-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 279.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 108 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1465.62 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|