C19H19NO2S — CID 135005228
tert-butyl 3-phenyl-1,4-benzothiazine-4-carboxylate (PubChem CID 135005228) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl 3-phenyl-1,4-benzothiazine-4-carboxylate.
| Compound Name | tert-butyl 3-phenyl-1,4-benzothiazine-4-carboxylate |
|---|---|
| PubChem CID | 135005228 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | tert-butyl 3-phenyl-1,4-benzothiazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccccc2)=CSc2ccccc21 |
| InChI | InChI=1S/C19H19NO2S/c1-19(2,3)22-18(21)20-15-11-7-8-12-17(15)23-13-16(20)14-9-5-4-6-10-14/h4-13H,1-3H3 |
| InChIKey | DBIPEFGINXHHAX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |