C18H18N2O3 — CID 135008725
tert-butyl 3-phenylpyrido[3,2-b][1,4]oxazine-4-carboxylate (PubChem CID 135008725) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl 3-phenylpyrido[3,2-b][1,4]oxazine-4-carboxylate.
| Compound Name | tert-butyl 3-phenylpyrido[3,2-b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 135008725 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | tert-butyl 3-phenylpyrido[3,2-b][1,4]oxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccccc2)=COc2cccnc21 |
| InChI | InChI=1S/C18H18N2O3/c1-18(2,3)23-17(21)20-14(13-8-5-4-6-9-13)12-22-15-10-7-11-19-16(15)20/h4-12H,1-3H3 |
| InChIKey | OFQCCJOYHWLEPA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |