C25H21NO7 — CID 16733219
tert-butyl 3,5-bis(1,4-benzodioxin-3-yl)-1,4-oxazine-4-carboxylate (PubChem CID 16733219) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is tert-butyl 3,5-bis(1,4-benzodioxin-3-yl)-1,4-oxazine-4-carboxylate.
| Compound Name | tert-butyl 3,5-bis(1,4-benzodioxin-3-yl)-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 16733219 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | tert-butyl 3,5-bis(1,4-benzodioxin-3-yl)-1,4-oxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C2=COc3ccccc3O2)=COC=C1C1=COc2ccccc2O1 |
| InChI | InChI=1S/C25H21NO7/c1-25(2,3)33-24(27)26-16(22-14-29-18-8-4-6-10-20(18)31-22)12-28-13-17(26)23-15-30-19-9-5-7-11-21(19)32-23/h4-15H,1-3H3 |
| InChIKey | RDPSXBROCFKQFP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |