C9H11Br2NO3 — CID 172993655
tert-butyl 3,5-dibromo-1,4-oxazine-4-carboxylate (PubChem CID 172993655) has the molecular formula C9H11Br2NO3 and a molecular weight of 341.00 g/mol. Its IUPAC name is tert-butyl 3,5-dibromo-1,4-oxazine-4-carboxylate.
| Compound Name | tert-butyl 3,5-dibromo-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 172993655 |
| Molecular Formula | C9H11Br2NO3 |
| Molecular Weight | 341.00 g/mol |
| Exact Mass | 338.91 |
| IUPAC Name | tert-butyl 3,5-dibromo-1,4-oxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(Br)=COC=C1Br |
| InChI | InChI=1S/C9H11Br2NO3/c1-9(2,3)15-8(13)12-6(10)4-14-5-7(12)11/h4-5H,1-3H3 |
| InChIKey | NIHNORXRBCLKGJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.00 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|