C11H13BrINO2S — CID 142544046
tert-butyl 2-bromo-3-iodosulfanyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate (PubChem CID 142544046) has the molecular formula C11H13BrINO2S and a molecular weight of 430.11 g/mol. Its IUPAC name is tert-butyl 2-bromo-3-iodosulfanyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate.
| Compound Name | tert-butyl 2-bromo-3-iodosulfanyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate |
|---|---|
| PubChem CID | 142544046 |
| Molecular Formula | C11H13BrINO2S |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 428.89 |
| IUPAC Name | tert-butyl 2-bromo-3-iodosulfanyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=CC1C(SI)=C2Br |
| InChI | InChI=1S/C11H13BrINO2S/c1-11(2,3)16-10(15)14-6-4-5-7(14)9(17-13)8(6)12/h4-7H,1-3H3 |
| InChIKey | BNILXKLWRGQKEP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|