C15H21NO3 — CID 10378071
tert-butyl (1R,5R)-2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate (PubChem CID 10378071) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl (1R,5R)-2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate.
| Compound Name | tert-butyl (1R,5R)-2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate |
|---|---|
| PubChem CID | 10378071 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | tert-butyl (1R,5R)-2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate |
| SMILES | CCC(=O)C1=CC[C@@H]2C=C[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO3/c1-5-13(17)11-8-6-10-7-9-12(11)16(10)14(18)19-15(2,3)4/h7-10,12H,5-6H2,1-4H3/t10-,12-/m1/s1 |
| InChIKey | ALZFJRUQHJEDIV-ZYHUDNBSSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|