C16H24ClHgNO4 — CID 102123665
CID 102123665 (PubChem CID 102123665) has the molecular formula C16H24ClHgNO4 and a molecular weight of 530.41 g/mol.
| Compound Name | CID 102123665 |
|---|---|
| PubChem CID | 102123665 |
| Molecular Formula | C16H24ClHgNO4 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | — |
| SMILES | CCC(=O)C1=CCC2[CH]C1C(OC)N2C(=O)OC(C)(C)C.[Cl-].[Hg+] |
| InChI | InChI=1S/C16H24NO4.ClH.Hg/c1-6-13(18)11-8-7-10-9-12(11)14(20-5)17(10)15(19)21-16(2,3)4;;/h8-10,12,14H,6-7H2,1-5H3;1H;/q;;+1/p-1 |
| InChIKey | BXUKWBJNFJTBCJ-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|