C17H23NO6 — CID 11759512
8-O-tert-butyl 2-O-(2-ethoxy-2-oxoethyl) (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate (PubChem CID 11759512) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-(2-ethoxy-2-oxoethyl) (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-(2-ethoxy-2-oxoethyl) (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 11759512 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 8-O-tert-butyl 2-O-(2-ethoxy-2-oxoethyl) (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
| SMILES | CCOC(=O)COC(=O)C1=CC[C@@H]2C=C[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO6/c1-5-22-14(19)10-23-15(20)12-8-6-11-7-9-13(12)18(11)16(21)24-17(2,3)4/h7-9,11,13H,5-6,10H2,1-4H3/t11-,13-/m1/s1 |
| InChIKey | OXYLCCMKETUSDO-DGCLKSJQSA-N |
| XLogP | 1.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|