C11H16INO2 — CID 153386486
tert-butyl (1S,4R)-2-iodo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (PubChem CID 153386486) has the molecular formula C11H16INO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is tert-butyl (1S,4R)-2-iodo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
| Compound Name | tert-butyl (1S,4R)-2-iodo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 153386486 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | tert-butyl (1S,4R)-2-iodo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2C=C(I)[C@@H]1CC2 |
| InChI | InChI=1S/C11H16INO2/c1-11(2,3)15-10(14)13-7-4-5-9(13)8(12)6-7/h6-7,9H,4-5H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | GCIKJPBBYTWAQD-APPZFPTMSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|