C11H18INO2 — CID 130665668
tert-butyl (2R)-5-iodo-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 130665668) has the molecular formula C11H18INO2 and a molecular weight of 323.17 g/mol. Its IUPAC name is tert-butyl (2R)-5-iodo-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2R)-5-iodo-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 130665668 |
| Molecular Formula | C11H18INO2 |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | tert-butyl (2R)-5-iodo-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C[C@@H]1CCC(I)=CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18INO2/c1-8-5-6-9(12)7-13(8)10(14)15-11(2,3)4/h7-8H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | CMMJRDBPRANUTN-MRVPVSSYSA-N |
| XLogP | 3.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|