C17H27NO6 — CID 139799398
ditert-butyl (2S)-5-acetyloxy-3,4-dihydro-2H-pyridine-1,2-dicarboxylate (PubChem CID 139799398) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is ditert-butyl (2S)-5-acetyloxy-3,4-dihydro-2H-pyridine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-5-acetyloxy-3,4-dihydro-2H-pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139799398 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | ditert-butyl (2S)-5-acetyloxy-3,4-dihydro-2H-pyridine-1,2-dicarboxylate |
| SMILES | CC(=O)OC1=CN(C(=O)OC(C)(C)C)[C@H](C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H27NO6/c1-11(19)22-12-8-9-13(14(20)23-16(2,3)4)18(10-12)15(21)24-17(5,6)7/h10,13H,8-9H2,1-7H3/t13-/m0/s1 |
| InChIKey | VONSLXMXMKWHIG-ZDUSSCGKSA-N |
| XLogP | 3.13 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|