C15H25NO5 — CID 118595373
ditert-butyl (2R)-4-oxopiperidine-1,2-dicarboxylate (PubChem CID 118595373) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is ditert-butyl (2R)-4-oxopiperidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R)-4-oxopiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118595373 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | ditert-butyl (2R)-4-oxopiperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CC(=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO5/c1-14(2,3)20-12(18)11-9-10(17)7-8-16(11)13(19)21-15(4,5)6/h11H,7-9H2,1-6H3/t11-/m1/s1 |
| InChIKey | XFSHUQRYLKZPLR-LLVKDONJSA-N |
| XLogP | 2.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |