C15H25NO4 — CID 18967904
ditert-butyl 4-methylidenepyrrolidine-1,2-dicarboxylate (PubChem CID 18967904) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is ditert-butyl 4-methylidenepyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4-methylidenepyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 18967904 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | ditert-butyl 4-methylidenepyrrolidine-1,2-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H25NO4/c1-10-8-11(12(17)19-14(2,3)4)16(9-10)13(18)20-15(5,6)7/h11H,1,8-9H2,2-7H3 |
| InChIKey | YGOWHMIOSLSPJC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|