C18H25NO2 — CID 134940406
tert-butyl (2R)-2-(3,5-dimethylphenyl)-4-methylidenepyrrolidine-1-carboxylate (PubChem CID 134940406) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl (2R)-2-(3,5-dimethylphenyl)-4-methylidenepyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(3,5-dimethylphenyl)-4-methylidenepyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134940406 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | tert-butyl (2R)-2-(3,5-dimethylphenyl)-4-methylidenepyrrolidine-1-carboxylate |
| SMILES | C=C1C[C@H](c2cc(C)cc(C)c2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H25NO2/c1-12-7-13(2)9-15(8-12)16-10-14(3)11-19(16)17(20)21-18(4,5)6/h7-9,16H,3,10-11H2,1-2,4-6H3/t16-/m1/s1 |
| InChIKey | VOCJAVJDDHWCOH-MRXNPFEDSA-N |
| XLogP | 4.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|