C16H17FN2O3 — CID 66691095
tert-butyl 2-(3-cyano-5-fluorophenyl)-4-oxopyrrolidine-1-carboxylate (PubChem CID 66691095) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is tert-butyl 2-(3-cyano-5-fluorophenyl)-4-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3-cyano-5-fluorophenyl)-4-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66691095 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | tert-butyl 2-(3-cyano-5-fluorophenyl)-4-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C16H17FN2O3/c1-16(2,3)22-15(21)19-9-13(20)7-14(19)11-4-10(8-18)5-12(17)6-11/h4-6,14H,7,9H2,1-3H3 |
| InChIKey | WEDCVMDPLYXWDU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |