About tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate
tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 66545572) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate.
Analyze tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate (CID 66545572) is tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate is CC1CCC=CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is RDLOVGLKQIICMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-9-7-5-6-8-12(9)10(13)14-11(2,3)4/h6,8-9H,5,7H2,1-4H3.
What are the key properties of tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate?
tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 197.28 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 66545572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).