C10H15NO4 — CID 174840532
tert-butyl 2-formyloxy-2,3-dihydropyrrole-1-carboxylate (PubChem CID 174840532) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is tert-butyl 2-formyloxy-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-formyloxy-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 174840532 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | tert-butyl 2-formyloxy-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CCC1OC=O |
| InChI | InChI=1S/C10H15NO4/c1-10(2,3)15-9(13)11-6-4-5-8(11)14-7-12/h4,6-8H,5H2,1-3H3 |
| InChIKey | SGKNZWRFDKWEOO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|