C18H25NO5Si — CID 15467987
4-O-tert-butyl 3-O-methyl 2-trimethylsilyl-1,4-benzoxazine-3,4-dicarboxylate (PubChem CID 15467987) has the molecular formula C18H25NO5Si and a molecular weight of 363.49 g/mol. Its IUPAC name is 4-O-tert-butyl 3-O-methyl 2-trimethylsilyl-1,4-benzoxazine-3,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 3-O-methyl 2-trimethylsilyl-1,4-benzoxazine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15467987 |
| Molecular Formula | C18H25NO5Si |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-O-tert-butyl 3-O-methyl 2-trimethylsilyl-1,4-benzoxazine-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C([Si](C)(C)C)Oc2ccccc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO5Si/c1-18(2,3)24-17(21)19-12-10-8-9-11-13(12)23-16(25(5,6)7)14(19)15(20)22-4/h8-11H,1-7H3 |
| InChIKey | JXABLDVRMQIYGY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|