C22H23NO2 — CID 11858652
tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate (PubChem CID 11858652) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11858652 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccccc2)=CCC=C1c1ccccc1 |
| InChI | InChI=1S/C22H23NO2/c1-22(2,3)25-21(24)23-19(17-11-6-4-7-12-17)15-10-16-20(23)18-13-8-5-9-14-18/h4-9,11-16H,10H2,1-3H3 |
| InChIKey | HRCPGAVEPYMEEX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |