tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate

C22H23NO2 — CID 11858652

IUPACtert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate
SMILESCC(C)(C)OC(=O)N1C(c2ccccc2)=CCC=C1c1ccccc1
InChIInChI=1S/C22H23NO2/c1-22(2,3)25-21(24)23-19(17-11-6-4-7-12-17)15-10-16-20(23)18-13-8-5-9-14-18/h4-9,11-16H,10H2,1-3H3
InChIKeyHRCPGAVEPYMEEX-UHFFFAOYSA-N
MW333.43 g/mol
LogP5.71
Rot. Bonds2

About tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate

tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate (PubChem CID 11858652) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate.

Molecular Properties

Compound Nametert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate
PubChem CID11858652
Molecular FormulaC22H23NO2
Molecular Weight333.43 g/mol
Exact Mass333.17
IUPAC Nametert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate
SMILESCC(C)(C)OC(=O)N1C(c2ccccc2)=CCC=C1c1ccccc1
InChIInChI=1S/C22H23NO2/c1-22(2,3)25-21(24)23-19(17-11-6-4-7-12-17)15-10-16-20(23)18-13-8-5-9-14-18/h4-9,11-16H,10H2,1-3H3
InChIKeyHRCPGAVEPYMEEX-UHFFFAOYSA-N
XLogP5.71
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500333.43
LogP ≤ 55.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate?
The IUPAC name of tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate (CID 11858652) is tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate.
What is the SMILES notation for tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate?
The canonical SMILES for tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate is CC(C)(C)OC(=O)N1C(c2ccccc2)=CCC=C1c1ccccc1.
What is the InChIKey of tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate?
The InChIKey is HRCPGAVEPYMEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2/c1-22(2,3)25-21(24)23-19(17-11-6-4-7-12-17)15-10-16-20(23)18-13-8-5-9-14-18/h4-9,11-16H,10H2,1-3H3.
What are the key properties of tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate?
tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate has a molecular weight of 333.43 g/mol, XLogP of 5.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,6-diphenyl-4H-pyridine-1-carboxylate is sourced from PubChem (CID 11858652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).