C23H23NO3 — CID 16733689
tert-butyl 2-ethenyl-3,5-diphenyl-1,4-oxazine-4-carboxylate (PubChem CID 16733689) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 2-ethenyl-3,5-diphenyl-1,4-oxazine-4-carboxylate.
| Compound Name | tert-butyl 2-ethenyl-3,5-diphenyl-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 16733689 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | tert-butyl 2-ethenyl-3,5-diphenyl-1,4-oxazine-4-carboxylate |
| SMILES | C=CC1=C(c2ccccc2)N(C(=O)OC(C)(C)C)C(c2ccccc2)=CO1 |
| InChI | InChI=1S/C23H23NO3/c1-5-20-21(18-14-10-7-11-15-18)24(22(25)27-23(2,3)4)19(16-26-20)17-12-8-6-9-13-17/h5-16H,1H2,2-4H3 |
| InChIKey | UBQWJSMZUYJASA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |