C30H36BN2O7P2- — CID 161238424
[deuterio(oxoboranyl)methyl]-phosphanylphosphane;ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate;methane (PubChem CID 161238424) has the molecular formula C30H36BN2O7P2- and a molecular weight of 610.39 g/mol. Its IUPAC name is [deuterio(oxoboranyl)methyl]-phosphanylphosphane;ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate;methane.
| Compound Name | [deuterio(oxoboranyl)methyl]-phosphanylphosphane;ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate;methane |
|---|---|
| PubChem CID | 161238424 |
| Molecular Formula | C30H36BN2O7P2- |
| Molecular Weight | 610.39 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | [deuterio(oxoboranyl)methyl]-phosphanylphosphane;ditert-butyl 3,6-dioxo-1,4-diphenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate;methane |
| SMILES | C.CC(C)(C)OC(=O)N1C(=O)C2=C(c3ccccc3)N(C(=O)OC(C)(C)C)C(=O)C2=C1c1ccccc1.[2H][C-](B=O)PP |
| InChI | InChI=1S/C28H28N2O6.CH4BOP2.CH4/c1-27(2,3)35-25(33)29-21(17-13-9-7-10-14-17)19-20(23(29)31)22(18-15-11-8-12-16-18)30(24(19)32)26(34)36-28(4,5)6;3-2-1-5-4;/h7-16H,1-6H3;1,5H,4H2;1H4/q;-1;/i;1D; |
| InChIKey | UZRGCAJRZLBYFP-RUHRIWTCSA-N |
| XLogP | 6.62 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.39 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|