C34H40N2O6 — CID 20743201
bis(2-methylbutan-2-yl) 4-(4-tert-butylphenyl)-3,6-dioxo-1-phenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (PubChem CID 20743201) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is bis(2-methylbutan-2-yl) 4-(4-tert-butylphenyl)-3,6-dioxo-1-phenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate.
| Compound Name | bis(2-methylbutan-2-yl) 4-(4-tert-butylphenyl)-3,6-dioxo-1-phenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 20743201 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | bis(2-methylbutan-2-yl) 4-(4-tert-butylphenyl)-3,6-dioxo-1-phenylpyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| SMILES | CCC(C)(C)OC(=O)N1C(=O)C2=C(c3ccc(C(C)(C)C)cc3)N(C(=O)OC(C)(C)CC)C(=O)C2=C1c1ccccc1 |
| InChI | InChI=1S/C34H40N2O6/c1-10-33(6,7)41-30(39)35-26(21-15-13-12-14-16-21)24-25(29(35)38)27(22-17-19-23(20-18-22)32(3,4)5)36(28(24)37)31(40)42-34(8,9)11-2/h12-20H,10-11H2,1-9H3 |
| InChIKey | RQBLAGDOWNLTAO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|