C21H27NO3 — CID 77440920
ethyl 4-amino-2-hydroxy-5-methyl-5-(4-phenylphenyl)hexanoate (PubChem CID 77440920) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is ethyl 4-amino-2-hydroxy-5-methyl-5-(4-phenylphenyl)hexanoate.
| Compound Name | ethyl 4-amino-2-hydroxy-5-methyl-5-(4-phenylphenyl)hexanoate |
|---|---|
| PubChem CID | 77440920 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | ethyl 4-amino-2-hydroxy-5-methyl-5-(4-phenylphenyl)hexanoate |
| SMILES | CCOC(=O)C(O)CC(N)C(C)(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-4-25-20(24)18(23)14-19(22)21(2,3)17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-13,18-19,23H,4,14,22H2,1-3H3 |
| InChIKey | KLRMHRNTUCTKKQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |