C18H27NO2 — CID 174192661
2-methylbutan-2-yl 4-methyl-4-phenylpiperidine-1-carboxylate (PubChem CID 174192661) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-methyl-4-phenylpiperidine-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl 4-methyl-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 174192661 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-methylbutan-2-yl 4-methyl-4-phenylpiperidine-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCC(C)(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-5-17(2,3)21-16(20)19-13-11-18(4,12-14-19)15-9-7-6-8-10-15/h6-10H,5,11-14H2,1-4H3 |
| InChIKey | XGBMIWYYEYKPQT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |