C17H25NO2 — CID 174192662
2-methylbutan-2-yl (3S)-3-methyl-3-phenylpyrrolidine-1-carboxylate (PubChem CID 174192662) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-methylbutan-2-yl (3S)-3-methyl-3-phenylpyrrolidine-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl (3S)-3-methyl-3-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174192662 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-methylbutan-2-yl (3S)-3-methyl-3-phenylpyrrolidine-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CC[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C17H25NO2/c1-5-16(2,3)20-15(19)18-12-11-17(4,13-18)14-9-7-6-8-10-14/h6-10H,5,11-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | CXIOYCNXLCIIGG-QGZVFWFLSA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |