C19H29NO2 — CID 129156425
ethyl 4-(4-tert-butylphenyl)-4-methylpiperidine-1-carboxylate (PubChem CID 129156425) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is ethyl 4-(4-tert-butylphenyl)-4-methylpiperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-tert-butylphenyl)-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129156425 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethyl 4-(4-tert-butylphenyl)-4-methylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C)(c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H29NO2/c1-6-22-17(21)20-13-11-19(5,12-14-20)16-9-7-15(8-10-16)18(2,3)4/h7-10H,6,11-14H2,1-5H3 |
| InChIKey | UCTHJRJJEYPQBZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |