About 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate
4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate (PubChem CID 167691603) has the molecular formula C27H36Br2N2O2
and a molecular weight of 580.41 g/mol. Its IUPAC name is 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate |
| PubChem CID | 167691603 |
| Molecular Formula | C27H36Br2N2O2 |
| Molecular Weight | 580.41 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate |
| SMILES | CC1(c2ccc(Br)cc2)CCNCC1.CCOC(=O)N1CCC(C)(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H20BrNO2.C12H16BrN/c1-3-19-14(18)17-10-8-15(2,9-11-17)12-4-6-13(16)7-5-12;1-12(6-8-14-9-7-12)10-2-4-11(13)5-3-10/h4-7H,3,8-11H2,1-2H3;2-5,14H,6-9H2,1H3 |
| InChIKey | XAJYLOPRFUNHGT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.41 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate?
The IUPAC name of 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate (CID 167691603) is 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate.
What is the SMILES notation for 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate?
The canonical SMILES for 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate is CC1(c2ccc(Br)cc2)CCNCC1.CCOC(=O)N1CCC(C)(c2ccc(Br)cc2)CC1.
What is the InChIKey of 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate?
The InChIKey is XAJYLOPRFUNHGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrNO2.C12H16BrN/c1-3-19-14(18)17-10-8-15(2,9-11-17)12-4-6-13(16)7-5-12;1-12(6-8-14-9-7-12)10-2-4-11(13)5-3-10/h4-7H,3,8-11H2,1-2H3;2-5,14H,6-9H2,1H3.
What are the key properties of 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate?
4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate has a molecular weight of 580.41 g/mol, XLogP of 7.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-4-methylpiperidine;ethyl 4-(4-bromophenyl)-4-methylpiperidine-1-carboxylate is sourced from PubChem (CID 167691603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).