About ethyl piperazine-1-carboxylate;sulfuric acid
ethyl piperazine-1-carboxylate;sulfuric acid (PubChem CID 69107916) has the molecular formula C7H16N2O6S
and a molecular weight of 256.28 g/mol. Its IUPAC name is ethyl piperazine-1-carboxylate;sulfuric acid.
Molecular Properties
| Compound Name | ethyl piperazine-1-carboxylate;sulfuric acid |
| PubChem CID | 69107916 |
| Molecular Formula | C7H16N2O6S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | ethyl piperazine-1-carboxylate;sulfuric acid |
| SMILES | CCOC(=O)N1CCNCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H14N2O2.H2O4S/c1-2-11-7(10)9-5-3-8-4-6-9;1-5(2,3)4/h8H,2-6H2,1H3;(H2,1,2,3,4) |
| InChIKey | JGOSBBXESFJFCE-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl piperazine-1-carboxylate;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl piperazine-1-carboxylate;sulfuric acid?
The IUPAC name of ethyl piperazine-1-carboxylate;sulfuric acid (CID 69107916) is ethyl piperazine-1-carboxylate;sulfuric acid.
What is the SMILES notation for ethyl piperazine-1-carboxylate;sulfuric acid?
The canonical SMILES for ethyl piperazine-1-carboxylate;sulfuric acid is CCOC(=O)N1CCNCC1.O=S(=O)(O)O.
What is the InChIKey of ethyl piperazine-1-carboxylate;sulfuric acid?
The InChIKey is JGOSBBXESFJFCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2.H2O4S/c1-2-11-7(10)9-5-3-8-4-6-9;1-5(2,3)4/h8H,2-6H2,1H3;(H2,1,2,3,4).
What are the key properties of ethyl piperazine-1-carboxylate;sulfuric acid?
ethyl piperazine-1-carboxylate;sulfuric acid has a molecular weight of 256.28 g/mol, XLogP of -0.60, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl piperazine-1-carboxylate;sulfuric acid is sourced from PubChem (CID 69107916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).