About ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one
ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one (PubChem CID 143592038) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one.
Molecular Properties
| Compound Name | ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one |
| PubChem CID | 143592038 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one |
| SMILES | CC.CCOC(=O)N1CCCC1.O=C1CCNCC1 |
| InChI | InChI=1S/C7H13NO2.C5H9NO.C2H6/c1-2-10-7(9)8-5-3-4-6-8;7-5-1-3-6-4-2-5;1-2/h2-6H2,1H3;6H,1-4H2;1-2H3 |
| InChIKey | XVFKGWQUFQHFHO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one?
The IUPAC name of ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one (CID 143592038) is ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one.
What is the SMILES notation for ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one?
The canonical SMILES for ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one is CC.CCOC(=O)N1CCCC1.O=C1CCNCC1.
What is the InChIKey of ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one?
The InChIKey is XVFKGWQUFQHFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C5H9NO.C2H6/c1-2-10-7(9)8-5-3-4-6-8;7-5-1-3-6-4-2-5;1-2/h2-6H2,1H3;6H,1-4H2;1-2H3.
What are the key properties of ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one?
ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one has a molecular weight of 272.39 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl pyrrolidine-1-carboxylate;piperidin-4-one is sourced from PubChem (CID 143592038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).