C17H25N3O4 — CID 46260454
ethyl 4-[2-(azepan-1-yl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate (PubChem CID 46260454) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl 4-[2-(azepan-1-yl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(azepan-1-yl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46260454 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | ethyl 4-[2-(azepan-1-yl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2c(N3CCCCCC3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-2-24-17(23)20-11-9-19(10-12-20)14-13(15(21)16(14)22)18-7-5-3-4-6-8-18/h2-12H2,1H3 |
| InChIKey | PTISLSNORVNWEH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|