About ethyl 4-oxopiperidine-1-carboxylate;methane
ethyl 4-oxopiperidine-1-carboxylate;methane (PubChem CID 143127714) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is ethyl 4-oxopiperidine-1-carboxylate;methane.
Molecular Properties
| Compound Name | ethyl 4-oxopiperidine-1-carboxylate;methane |
| PubChem CID | 143127714 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | ethyl 4-oxopiperidine-1-carboxylate;methane |
| SMILES | C.CCOC(=O)N1CCC(=O)CC1 |
| InChI | InChI=1S/C8H13NO3.CH4/c1-2-12-8(11)9-5-3-7(10)4-6-9;/h2-6H2,1H3;1H4 |
| InChIKey | MRGUNBDEFJKKAD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-oxopiperidine-1-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxopiperidine-1-carboxylate;methane?
The IUPAC name of ethyl 4-oxopiperidine-1-carboxylate;methane (CID 143127714) is ethyl 4-oxopiperidine-1-carboxylate;methane.
What is the SMILES notation for ethyl 4-oxopiperidine-1-carboxylate;methane?
The canonical SMILES for ethyl 4-oxopiperidine-1-carboxylate;methane is C.CCOC(=O)N1CCC(=O)CC1.
What is the InChIKey of ethyl 4-oxopiperidine-1-carboxylate;methane?
The InChIKey is MRGUNBDEFJKKAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3.CH4/c1-2-12-8(11)9-5-3-7(10)4-6-9;/h2-6H2,1H3;1H4.
What are the key properties of ethyl 4-oxopiperidine-1-carboxylate;methane?
ethyl 4-oxopiperidine-1-carboxylate;methane has a molecular weight of 187.24 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxopiperidine-1-carboxylate;methane is sourced from PubChem (CID 143127714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).