About ethane;propan-2-yl piperazine-1-carboxylate
ethane;propan-2-yl piperazine-1-carboxylate (PubChem CID 142145252) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is ethane;propan-2-yl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;propan-2-yl piperazine-1-carboxylate |
| PubChem CID | 142145252 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethane;propan-2-yl piperazine-1-carboxylate |
| SMILES | CC.CC(C)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C8H16N2O2.C2H6/c1-7(2)12-8(11)10-5-3-9-4-6-10;1-2/h7,9H,3-6H2,1-2H3;1-2H3 |
| InChIKey | PRVFCTJZUTUTMC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propan-2-yl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl piperazine-1-carboxylate?
The IUPAC name of ethane;propan-2-yl piperazine-1-carboxylate (CID 142145252) is ethane;propan-2-yl piperazine-1-carboxylate.
What is the SMILES notation for ethane;propan-2-yl piperazine-1-carboxylate?
The canonical SMILES for ethane;propan-2-yl piperazine-1-carboxylate is CC.CC(C)OC(=O)N1CCNCC1.
What is the InChIKey of ethane;propan-2-yl piperazine-1-carboxylate?
The InChIKey is PRVFCTJZUTUTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2.C2H6/c1-7(2)12-8(11)10-5-3-9-4-6-10;1-2/h7,9H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;propan-2-yl piperazine-1-carboxylate?
ethane;propan-2-yl piperazine-1-carboxylate has a molecular weight of 202.30 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl piperazine-1-carboxylate is sourced from PubChem (CID 142145252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).