C22H26ClNO — CID 11717371
2-(4-chlorophenyl)-2-methyl-1-(4-methyl-4-phenylpiperidin-1-yl)propan-1-one (PubChem CID 11717371) has the molecular formula C22H26ClNO and a molecular weight of 355.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-methyl-1-(4-methyl-4-phenylpiperidin-1-yl)propan-1-one.
| Compound Name | 2-(4-chlorophenyl)-2-methyl-1-(4-methyl-4-phenylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 11717371 |
| Molecular Formula | C22H26ClNO |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-(4-chlorophenyl)-2-methyl-1-(4-methyl-4-phenylpiperidin-1-yl)propan-1-one |
| SMILES | CC1(c2ccccc2)CCN(C(=O)C(C)(C)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H26ClNO/c1-21(2,17-9-11-19(23)12-10-17)20(25)24-15-13-22(3,14-16-24)18-7-5-4-6-8-18/h4-12H,13-16H2,1-3H3 |
| InChIKey | YLNDDTBFMRYPPP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |