C23H27NO3 — CID 119168579
1-[2-methyl-2-(4-methylphenyl)propanoyl]-4-phenylpiperidine-4-carboxylic acid (PubChem CID 119168579) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-[2-methyl-2-(4-methylphenyl)propanoyl]-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-[2-methyl-2-(4-methylphenyl)propanoyl]-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119168579 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-[2-methyl-2-(4-methylphenyl)propanoyl]-4-phenylpiperidine-4-carboxylic acid |
| SMILES | Cc1ccc(C(C)(C)C(=O)N2CCC(C(=O)O)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-17-9-11-18(12-10-17)22(2,3)20(25)24-15-13-23(14-16-24,21(26)27)19-7-5-4-6-8-19/h4-12H,13-16H2,1-3H3,(H,26,27) |
| InChIKey | AKKJPEWLHVPRKH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |