C28H40ClNO2Si — CID 154253554
1-[4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-2-(4-chlorophenyl)-2-methylpropan-1-one (PubChem CID 154253554) has the molecular formula C28H40ClNO2Si and a molecular weight of 486.17 g/mol. Its IUPAC name is 1-[4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-2-(4-chlorophenyl)-2-methylpropan-1-one.
| Compound Name | 1-[4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-2-(4-chlorophenyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 154253554 |
| Molecular Formula | C28H40ClNO2Si |
| Molecular Weight | 486.17 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 1-[4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-2-(4-chlorophenyl)-2-methylpropan-1-one |
| SMILES | CC(C)(C)[SiH2]OC(C)(C)C1(c2ccccc2)CCN(C(=O)C(C)(C)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H40ClNO2Si/c1-25(2,3)33-32-27(6,7)28(22-11-9-8-10-12-22)17-19-30(20-18-28)24(31)26(4,5)21-13-15-23(29)16-14-21/h8-16H,17-20,33H2,1-7H3 |
| InChIKey | BJVKDWJFLHFUFJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.17 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|