C31H45NO3Si — CID 154427186
[4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone (PubChem CID 154427186) has the molecular formula C31H45NO3Si and a molecular weight of 507.79 g/mol. Its IUPAC name is [4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone.
| Compound Name | [4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 154427186 |
| Molecular Formula | C31H45NO3Si |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | [4-(2-tert-butylsilyloxypropan-2-yl)-4-phenylpiperidin-1-yl]-[1-(4-methoxyphenyl)cyclopentyl]methanone |
| SMILES | COc1ccc(C2(C(=O)N3CCC(c4ccccc4)(C(C)(C)O[SiH2]C(C)(C)C)CC3)CCCC2)cc1 |
| InChI | InChI=1S/C31H45NO3Si/c1-28(2,3)36-35-29(4,5)31(25-12-8-7-9-13-25)20-22-32(23-21-31)27(33)30(18-10-11-19-30)24-14-16-26(34-6)17-15-24/h7-9,12-17H,10-11,18-23,36H2,1-6H3 |
| InChIKey | STCQXRCYJLVZLM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|