C25H26N2O — CID 21022116
4-methyl-N,N,4-triphenylpiperidine-1-carboxamide (PubChem CID 21022116) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-methyl-N,N,4-triphenylpiperidine-1-carboxamide.
| Compound Name | 4-methyl-N,N,4-triphenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 21022116 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-methyl-N,N,4-triphenylpiperidine-1-carboxamide |
| SMILES | CC1(c2ccccc2)CCN(C(=O)N(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H26N2O/c1-25(21-11-5-2-6-12-21)17-19-26(20-18-25)24(28)27(22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16H,17-20H2,1H3 |
| InChIKey | IXMXBIPWUOYMLU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |