C23H23N3O2 — CID 14302847
4-(2-hydroxyphenyl)-N,N-diphenylpiperazine-1-carboxamide (PubChem CID 14302847) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N,N-diphenylpiperazine-1-carboxamide.
| Compound Name | 4-(2-hydroxyphenyl)-N,N-diphenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 14302847 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N,N-diphenylpiperazine-1-carboxamide |
| SMILES | O=C(N1CCN(c2ccccc2O)CC1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O2/c27-22-14-8-7-13-21(22)24-15-17-25(18-16-24)23(28)26(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,27H,15-18H2 |
| InChIKey | XAIJAZIUDJWWLR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |