C12H13F3N2O2 — CID 62491643
2,2,2-trifluoro-1-[4-(2-hydroxyphenyl)piperazin-1-yl]ethanone (PubChem CID 62491643) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(2-hydroxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-(2-hydroxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 62491643 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(2-hydroxyphenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(c2ccccc2O)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)11(19)17-7-5-16(6-8-17)9-3-1-2-4-10(9)18/h1-4,18H,5-8H2 |
| InChIKey | MZYDPDCJFQHATQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |