C17H16F2N2O2 — CID 78802706
(2,5-difluorophenyl)-[4-(2-hydroxyphenyl)piperazin-1-yl]methanone (PubChem CID 78802706) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[4-(2-hydroxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (2,5-difluorophenyl)-[4-(2-hydroxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 78802706 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (2,5-difluorophenyl)-[4-(2-hydroxyphenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1F)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C17H16F2N2O2/c18-12-5-6-14(19)13(11-12)17(23)21-9-7-20(8-10-21)15-3-1-2-4-16(15)22/h1-6,11,22H,7-10H2 |
| InChIKey | FDHPXOCZYVXQOE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |