C16H14N2O4 — CID 134874656
(2R,3S)-2,4-dihydroxy-1-oxido-3,6-diphenyl-2,3-dihydropyrazin-1-ium-5-one (PubChem CID 134874656) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2R,3S)-2,4-dihydroxy-1-oxido-3,6-diphenyl-2,3-dihydropyrazin-1-ium-5-one.
| Compound Name | (2R,3S)-2,4-dihydroxy-1-oxido-3,6-diphenyl-2,3-dihydropyrazin-1-ium-5-one |
|---|---|
| PubChem CID | 134874656 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2R,3S)-2,4-dihydroxy-1-oxido-3,6-diphenyl-2,3-dihydropyrazin-1-ium-5-one |
| SMILES | O=C1C(c2ccccc2)=[N+]([O-])[C@H](O)[C@H](c2ccccc2)N1O |
| InChI | InChI=1S/C16H14N2O4/c19-15-13(11-7-3-1-4-8-11)17(21)16(20)14(18(15)22)12-9-5-2-6-10-12/h1-10,13,15,19,21H/t13-,15+/m0/s1 |
| InChIKey | YTHPAGOFADVJMS-DZGCQCFKSA-N |
| XLogP | 1.28 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|