C17H12O3 — CID 10923402
4-hydroxy-1-phenyl-3a,4-dihydroindeno[2,1-b]furan-2-one (PubChem CID 10923402) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-hydroxy-1-phenyl-3a,4-dihydroindeno[2,1-b]furan-2-one.
| Compound Name | 4-hydroxy-1-phenyl-3a,4-dihydroindeno[2,1-b]furan-2-one |
|---|---|
| PubChem CID | 10923402 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-hydroxy-1-phenyl-3a,4-dihydroindeno[2,1-b]furan-2-one |
| SMILES | O=C1OC2C(=C1c1ccccc1)c1ccccc1C2O |
| InChI | InChI=1S/C17H12O3/c18-15-12-9-5-4-8-11(12)14-13(17(19)20-16(14)15)10-6-2-1-3-7-10/h1-9,15-16,18H |
| InChIKey | XVUDJSSBOFNKBC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|