C33H28O — CID 142347274
2,5-bis(3,5-dimethylphenyl)-3,4-diphenylcyclopenta-2,4-dien-1-one (PubChem CID 142347274) has the molecular formula C33H28O and a molecular weight of 440.59 g/mol. Its IUPAC name is 2,5-bis(3,5-dimethylphenyl)-3,4-diphenylcyclopenta-2,4-dien-1-one.
| Compound Name | 2,5-bis(3,5-dimethylphenyl)-3,4-diphenylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 142347274 |
| Molecular Formula | C33H28O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2,5-bis(3,5-dimethylphenyl)-3,4-diphenylcyclopenta-2,4-dien-1-one |
| SMILES | Cc1cc(C)cc(C2=C(c3ccccc3)C(c3ccccc3)=C(c3cc(C)cc(C)c3)C2=O)c1 |
| InChI | InChI=1S/C33H28O/c1-21-15-22(2)18-27(17-21)31-29(25-11-7-5-8-12-25)30(26-13-9-6-10-14-26)32(33(31)34)28-19-23(3)16-24(4)20-28/h5-20H,1-4H3 |
| InChIKey | VXAMQGDNCQFCDT-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|